C20H29NO — CID 123456548
1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-cyclohexa-1,5-dien-1-ylprop-2-en-1-one (PubChem CID 123456548) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-cyclohexa-1,5-dien-1-ylprop-2-en-1-one.
| Compound Name | 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-cyclohexa-1,5-dien-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 123456548 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 1-(1-tert-butyl-4,4-dimethyl-2,3-dihydropyridin-5-yl)-3-cyclohexa-1,5-dien-1-ylprop-2-en-1-one |
| SMILES | CC1(C)CCN(C(C)(C)C)C=C1C(=O)C=CC1=CCCC=C1 |
| InChI | InChI=1S/C20H29NO/c1-19(2,3)21-14-13-20(4,5)17(15-21)18(22)12-11-16-9-7-6-8-10-16/h7,9-12,15H,6,8,13-14H2,1-5H3 |
| InChIKey | VSKDUPJBVYBGNR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|