About N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide
N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide (PubChem CID 123456692) has the molecular formula C20H23F2N3O
and a molecular weight of 359.42 g/mol. Its IUPAC name is N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide.
Molecular Properties
| Compound Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide |
| PubChem CID | 123456692 |
| Molecular Formula | C20H23F2N3O |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide |
| SMILES | CC(F)(F)c1ccc(C/N=C(\N)c2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C20H23F2N3O/c1-20(21,22)17-6-2-15(3-7-17)14-24-19(23)16-4-8-18(9-5-16)25-10-12-26-13-11-25/h2-9H,10-14H2,1H3,(H2,23,24) |
| InChIKey | JMZNFQDHKROSBE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide?
The IUPAC name of N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide (CID 123456692) is N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide.
What is the SMILES notation for N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide?
The canonical SMILES for N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide is CC(F)(F)c1ccc(C/N=C(\N)c2ccc(N3CCOCC3)cc2)cc1.
What is the InChIKey of N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide?
The InChIKey is JMZNFQDHKROSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2N3O/c1-20(21,22)17-6-2-15(3-7-17)14-24-19(23)16-4-8-18(9-5-16)25-10-12-26-13-11-25/h2-9H,10-14H2,1H3,(H2,23,24).
What are the key properties of N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide?
N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide has a molecular weight of 359.42 g/mol, XLogP of 3.54, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-4-morpholin-4-ylbenzenecarboximidamide is sourced from PubChem (CID 123456692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).