C60H42N4 — CID 123456756
10-[4-[3-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]phenyl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 123456756) has the molecular formula C60H42N4 and a molecular weight of 819.02 g/mol. Its IUPAC name is 10-[4-[3-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]phenyl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 10-[4-[3-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]phenyl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 123456756 |
| Molecular Formula | C60H42N4 |
| Molecular Weight | 819.02 g/mol |
| Exact Mass | 818.34 |
| IUPAC Name | 10-[4-[3-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]phenyl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | CC1(C)c2ccccc2-n2c3ccccc3c3cc(-c4ccc(-c5cccc(-c6cccc(-c7ccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)cc7)c6)c5)cc4)cc1c32 |
| InChI | InChI=1S/C60H42N4/c1-60(2)52-24-10-12-26-55(52)64-54-25-11-9-23-50(54)51-37-49(38-53(60)56(51)64)41-29-27-39(28-30-41)45-19-13-21-47(35-45)48-22-14-20-46(36-48)40-31-33-44(34-32-40)59-62-57(42-15-5-3-6-16-42)61-58(63-59)43-17-7-4-8-18-43/h3-38H,1-2H3 |
| InChIKey | QBZOSEQDHWYTJX-UHFFFAOYSA-N |
| XLogP | 15.28 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.02 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |