About 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole
6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole (PubChem CID 123456855) has the molecular formula C9H11FN2
and a molecular weight of 166.20 g/mol. Its IUPAC name is 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole |
| PubChem CID | 123456855 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole |
| SMILES | Cc1nc2c([nH]1)CC(C)(F)C=C2 |
| InChI | InChI=1S/C9H11FN2/c1-6-11-7-3-4-9(2,10)5-8(7)12-6/h3-4H,5H2,1-2H3,(H,11,12) |
| InChIKey | MBHADNMMKJCAKQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole?
The IUPAC name of 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole (CID 123456855) is 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole.
What is the SMILES notation for 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole?
The canonical SMILES for 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole is Cc1nc2c([nH]1)CC(C)(F)C=C2.
What is the InChIKey of 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole?
The InChIKey is MBHADNMMKJCAKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2/c1-6-11-7-3-4-9(2,10)5-8(7)12-6/h3-4H,5H2,1-2H3,(H,11,12).
What are the key properties of 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole?
6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole has a molecular weight of 166.20 g/mol, XLogP of 2.02, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,6-dimethyl-1,7-dihydrobenzimidazole is sourced from PubChem (CID 123456855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).