C10H6O3 — CID 123457192
11-oxatricyclo[6.2.1.02,7]undeca-1(10),2,4,6,8-pentaene-3,6-diol (PubChem CID 123457192) has the molecular formula C10H6O3 and a molecular weight of 174.15 g/mol. Its IUPAC name is 11-oxatricyclo[6.2.1.02,7]undeca-1(10),2,4,6,8-pentaene-3,6-diol.
| Compound Name | 11-oxatricyclo[6.2.1.02,7]undeca-1(10),2,4,6,8-pentaene-3,6-diol |
|---|---|
| PubChem CID | 123457192 |
| Molecular Formula | C10H6O3 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 11-oxatricyclo[6.2.1.02,7]undeca-1(10),2,4,6,8-pentaene-3,6-diol |
| SMILES | Oc1ccc(O)c2c3ccc(o3)c12 |
| InChI | InChI=1S/C10H6O3/c11-5-1-2-6(12)10-8-4-3-7(13-8)9(5)10/h1-4,11-12H |
| InChIKey | DFWADGXLCANGIX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|