About 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium
4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium (PubChem CID 123457238) has the molecular formula C7H6ClN2S+
and a molecular weight of 185.66 g/mol. Its IUPAC name is 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium.
Molecular Properties
| Compound Name | 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium |
| PubChem CID | 123457238 |
| Molecular Formula | C7H6ClN2S+ |
| Molecular Weight | 185.66 g/mol |
| Exact Mass | 184.99 |
| IUPAC Name | 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium |
| SMILES | C[n+]1cnc2ccsc2c1Cl |
| InChI | InChI=1S/C7H6ClN2S/c1-10-4-9-5-2-3-11-6(5)7(10)8/h2-4H,1H3/q+1 |
| InChIKey | GCPMEUMHIKMEDW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.66 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium?
The IUPAC name of 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium (CID 123457238) is 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium.
What is the SMILES notation for 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium?
The canonical SMILES for 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium is C[n+]1cnc2ccsc2c1Cl.
What is the InChIKey of 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium?
The InChIKey is GCPMEUMHIKMEDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN2S/c1-10-4-9-5-2-3-11-6(5)7(10)8/h2-4H,1H3/q+1.
What are the key properties of 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium?
4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium has a molecular weight of 185.66 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-methylthieno[3,2-d]pyrimidin-3-ium is sourced from PubChem (CID 123457238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).