C26H38N2O — CID 123457353
4-[1-[[4-[(4-imino-3,5-dimethylcyclohexen-1-yl)methyl]-2,6-dimethylcyclohex-2-en-1-ylidene]amino]ethyl]cyclohept-4-en-1-one (PubChem CID 123457353) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is 4-[1-[[4-[(4-imino-3,5-dimethylcyclohexen-1-yl)methyl]-2,6-dimethylcyclohex-2-en-1-ylidene]amino]ethyl]cyclohept-4-en-1-one.
| Compound Name | 4-[1-[[4-[(4-imino-3,5-dimethylcyclohexen-1-yl)methyl]-2,6-dimethylcyclohex-2-en-1-ylidene]amino]ethyl]cyclohept-4-en-1-one |
|---|---|
| PubChem CID | 123457353 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 4-[1-[[4-[(4-imino-3,5-dimethylcyclohexen-1-yl)methyl]-2,6-dimethylcyclohex-2-en-1-ylidene]amino]ethyl]cyclohept-4-en-1-one |
| SMILES | [H]/N=C1\C(C)C=C(CC2C=C(C)/C(=N/C(C)C3=CCCC(=O)CC3)C(C)C2)CC1C |
| InChI | InChI=1S/C26H38N2O/c1-16-11-21(12-17(2)25(16)27)15-22-13-18(3)26(19(4)14-22)28-20(5)23-7-6-8-24(29)10-9-23/h7,11,13,16-17,19-20,22,27H,6,8-10,12,14-15H2,1-5H3/b27-25+,28-26- |
| InChIKey | BEAXNONFHIKJKX-MPCWFZQZSA-N |
| XLogP | 6.50 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|