C9H17N5 — CID 123457613
1-(5-butan-2-yl-1H-1,2,4-triazol-3-yl)-1-prop-2-enylhydrazine (PubChem CID 123457613) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-(5-butan-2-yl-1H-1,2,4-triazol-3-yl)-1-prop-2-enylhydrazine.
| Compound Name | 1-(5-butan-2-yl-1H-1,2,4-triazol-3-yl)-1-prop-2-enylhydrazine |
|---|---|
| PubChem CID | 123457613 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 1-(5-butan-2-yl-1H-1,2,4-triazol-3-yl)-1-prop-2-enylhydrazine |
| SMILES | C=CCN(N)c1n[nH]c(C(C)CC)n1 |
| InChI | InChI=1S/C9H17N5/c1-4-6-14(10)9-11-8(12-13-9)7(3)5-2/h4,7H,1,5-6,10H2,2-3H3,(H,11,12,13) |
| InChIKey | AQXMMPPMHFWUQE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|