About 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol
7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol (PubChem CID 123457983) has the molecular formula C14H9FN2O2S
and a molecular weight of 288.30 g/mol. Its IUPAC name is 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol.
Molecular Properties
| Compound Name | 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol |
| PubChem CID | 123457983 |
| Molecular Formula | C14H9FN2O2S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol |
| SMILES | OC1Oc2cc(F)ccc2C=C1c1cn2ccsc2n1 |
| InChI | InChI=1S/C14H9FN2O2S/c15-9-2-1-8-5-10(13(18)19-12(8)6-9)11-7-17-3-4-20-14(17)16-11/h1-7,13,18H |
| InChIKey | OFIQYJCQXJLTDC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol?
The IUPAC name of 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol (CID 123457983) is 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol.
What is the SMILES notation for 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol?
The canonical SMILES for 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol is OC1Oc2cc(F)ccc2C=C1c1cn2ccsc2n1.
What is the InChIKey of 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol?
The InChIKey is OFIQYJCQXJLTDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN2O2S/c15-9-2-1-8-5-10(13(18)19-12(8)6-9)11-7-17-3-4-20-14(17)16-11/h1-7,13,18H.
What are the key properties of 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol?
7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol has a molecular weight of 288.30 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3-imidazo[2,1-b][1,3]thiazol-6-yl-2H-chromen-2-ol is sourced from PubChem (CID 123457983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).