C8H10O7 — CID 123458005
2-hydroxypent-3-ene-1,2,3-tricarboxylic acid (PubChem CID 123458005) has the molecular formula C8H10O7 and a molecular weight of 218.16 g/mol. Its IUPAC name is 2-hydroxypent-3-ene-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxypent-3-ene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 123458005 |
| Molecular Formula | C8H10O7 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 2-hydroxypent-3-ene-1,2,3-tricarboxylic acid |
| SMILES | CC=C(C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H10O7/c1-2-4(6(11)12)8(15,7(13)14)3-5(9)10/h2,15H,3H2,1H3,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | SFDQRSVJXQSEHM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|