C8H11NO — CID 123458239
1,2,3,3a,7,7a-hexahydroindol-4-one (PubChem CID 123458239) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1,2,3,3a,7,7a-hexahydroindol-4-one.
| Compound Name | 1,2,3,3a,7,7a-hexahydroindol-4-one |
|---|---|
| PubChem CID | 123458239 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1,2,3,3a,7,7a-hexahydroindol-4-one |
| SMILES | O=C1C=CCC2NCCC12 |
| InChI | InChI=1S/C8H11NO/c10-8-3-1-2-7-6(8)4-5-9-7/h1,3,6-7,9H,2,4-5H2 |
| InChIKey | LPQGFPGYRNEPCY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |