C20H21N6O3S+ — CID 123458282
CID 123458282 (PubChem CID 123458282) has the molecular formula C20H21N6O3S+ and a molecular weight of 425.49 g/mol.
| Compound Name | CID 123458282 |
|---|---|
| PubChem CID | 123458282 |
| Molecular Formula | C20H21N6O3S+ |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | — |
| SMILES | [CH2+]c1cc(S(N)(=O)=O)ccc1C(=O)N1CCN(c2ncnc3[nH]ccc23)CC12CC2 |
| InChI | InChI=1S/C20H21N6O3S/c1-13-10-14(30(21,28)29)2-3-15(13)19(27)26-9-8-25(11-20(26)5-6-20)18-16-4-7-22-17(16)23-12-24-18/h2-4,7,10,12H,1,5-6,8-9,11H2,(H2,21,28,29)(H,22,23,24)/q+1 |
| InChIKey | AIXYXYKGWDLFNQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|