C19H36 — CID 123458353
1,3-diethyl-3,5-dimethyl-7-(2-methylpropyl)-1,2,3a,4,5,6,7,7a-octahydroindene (PubChem CID 123458353) has the molecular formula C19H36 and a molecular weight of 264.50 g/mol. Its IUPAC name is 1,3-diethyl-3,5-dimethyl-7-(2-methylpropyl)-1,2,3a,4,5,6,7,7a-octahydroindene.
| Compound Name | 1,3-diethyl-3,5-dimethyl-7-(2-methylpropyl)-1,2,3a,4,5,6,7,7a-octahydroindene |
|---|---|
| PubChem CID | 123458353 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 1,3-diethyl-3,5-dimethyl-7-(2-methylpropyl)-1,2,3a,4,5,6,7,7a-octahydroindene |
| SMILES | CCC1CC(C)(CC)C2CC(C)CC(CC(C)C)C12 |
| InChI | InChI=1S/C19H36/c1-7-15-12-19(6,8-2)17-11-14(5)10-16(18(15)17)9-13(3)4/h13-18H,7-12H2,1-6H3 |
| InChIKey | DFIYJSOQOXZSJB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |