C25H30N2O5 — CID 123459002
[1-[2-[2-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]quinolin-7-yl]ethenyl]-4-oxocyclohexyl] formate (PubChem CID 123459002) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is [1-[2-[2-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]quinolin-7-yl]ethenyl]-4-oxocyclohexyl] formate.
| Compound Name | [1-[2-[2-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]quinolin-7-yl]ethenyl]-4-oxocyclohexyl] formate |
|---|---|
| PubChem CID | 123459002 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [1-[2-[2-[(1R)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]quinolin-7-yl]ethenyl]-4-oxocyclohexyl] formate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1ccc2ccc(C=CC3(OC=O)CCC(=O)CC3)cc2n1 |
| InChI | InChI=1S/C25H30N2O5/c1-17(26-23(30)32-24(2,3)4)21-8-7-19-6-5-18(15-22(19)27-21)9-12-25(31-16-28)13-10-20(29)11-14-25/h5-9,12,15-17H,10-11,13-14H2,1-4H3,(H,26,30)/t17-/m1/s1 |
| InChIKey | XOMLUVFGOMLCIK-QGZVFWFLSA-N |
| XLogP | 4.89 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|