C28H33FN3O2+ — CID 123459023
(4,4-dimethylpiperazin-4-ium-1-yl)-[2-[4-(4-fluoro-2-propan-2-ylphenoxy)phenyl]-6-methyl-4-pyridinyl]methanone (PubChem CID 123459023) has the molecular formula C28H33FN3O2+ and a molecular weight of 462.59 g/mol. Its IUPAC name is (4,4-dimethylpiperazin-4-ium-1-yl)-[2-[4-(4-fluoro-2-propan-2-ylphenoxy)phenyl]-6-methyl-4-pyridinyl]methanone.
| Compound Name | (4,4-dimethylpiperazin-4-ium-1-yl)-[2-[4-(4-fluoro-2-propan-2-ylphenoxy)phenyl]-6-methyl-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 123459023 |
| Molecular Formula | C28H33FN3O2+ |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (4,4-dimethylpiperazin-4-ium-1-yl)-[2-[4-(4-fluoro-2-propan-2-ylphenoxy)phenyl]-6-methyl-4-pyridinyl]methanone |
| SMILES | Cc1cc(C(=O)N2CC[N+](C)(C)CC2)cc(-c2ccc(Oc3ccc(F)cc3C(C)C)cc2)n1 |
| InChI | InChI=1S/C28H33FN3O2/c1-19(2)25-18-23(29)8-11-27(25)34-24-9-6-21(7-10-24)26-17-22(16-20(3)30-26)28(33)31-12-14-32(4,5)15-13-31/h6-11,16-19H,12-15H2,1-5H3/q+1 |
| InChIKey | MAMLEXOHHDHYGD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|