C8H16N2O2 — CID 123459270
2-methyl-1-propanimidoylpyrrolidine-3,4-diol (PubChem CID 123459270) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-methyl-1-propanimidoylpyrrolidine-3,4-diol.
| Compound Name | 2-methyl-1-propanimidoylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 123459270 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-methyl-1-propanimidoylpyrrolidine-3,4-diol |
| SMILES | [H]/N=C(\CC)N1CC(O)C(O)C1C |
| InChI | InChI=1S/C8H16N2O2/c1-3-7(9)10-4-6(11)8(12)5(10)2/h5-6,8-9,11-12H,3-4H2,1-2H3/b9-7+ |
| InChIKey | WQMWONCHSWHSRF-VQHVLOKHSA-N |
| XLogP | -0.20 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|