C25H44O2 — CID 123459837
2-[cyclohexyl(ethoxy)methoxy]-5-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,3-diene (PubChem CID 123459837) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is 2-[cyclohexyl(ethoxy)methoxy]-5-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,3-diene.
| Compound Name | 2-[cyclohexyl(ethoxy)methoxy]-5-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123459837 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | 2-[cyclohexyl(ethoxy)methoxy]-5-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,3-diene |
| SMILES | CCOC(OC1=CCC(C(CC(C)(C)C)C(C)(C)C)C=C1)C1CCCCC1 |
| InChI | InChI=1S/C25H44O2/c1-8-26-23(20-12-10-9-11-13-20)27-21-16-14-19(15-17-21)22(25(5,6)7)18-24(2,3)4/h14,16-17,19-20,22-23H,8-13,15,18H2,1-7H3 |
| InChIKey | WJLYCPNHIAMSGV-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|