About 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol
1-(6-chloro-1,7-naphthyridin-3-yl)ethanol (PubChem CID 123460576) has the molecular formula C10H9ClN2O
and a molecular weight of 208.65 g/mol. Its IUPAC name is 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol.
Molecular Properties
| Compound Name | 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol |
| PubChem CID | 123460576 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol |
| SMILES | CC(O)c1cnc2cnc(Cl)cc2c1 |
| InChI | InChI=1S/C10H9ClN2O/c1-6(14)8-2-7-3-10(11)13-5-9(7)12-4-8/h2-6,14H,1H3 |
| InChIKey | PGVMSBZJLNGBDR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol?
The IUPAC name of 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol (CID 123460576) is 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol.
What is the SMILES notation for 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol?
The canonical SMILES for 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol is CC(O)c1cnc2cnc(Cl)cc2c1.
What is the InChIKey of 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol?
The InChIKey is PGVMSBZJLNGBDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O/c1-6(14)8-2-7-3-10(11)13-5-9(7)12-4-8/h2-6,14H,1H3.
What are the key properties of 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol?
1-(6-chloro-1,7-naphthyridin-3-yl)ethanol has a molecular weight of 208.65 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-1,7-naphthyridin-3-yl)ethanol is sourced from PubChem (CID 123460576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).