About 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile
4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile (PubChem CID 123460708) has the molecular formula C25H27N5OS
and a molecular weight of 445.59 g/mol. Its IUPAC name is 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile |
| PubChem CID | 123460708 |
| Molecular Formula | C25H27N5OS |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile |
| SMILES | CC1CN(c2ncc(Sc3ccc(C#N)cc3)c(OCc3ccccc3)n2)C(C)CN1C |
| InChI | InChI=1S/C25H27N5OS/c1-18-16-30(19(2)15-29(18)3)25-27-14-23(32-22-11-9-20(13-26)10-12-22)24(28-25)31-17-21-7-5-4-6-8-21/h4-12,14,18-19H,15-17H2,1-3H3 |
| InChIKey | ORRAKGDDYALOBK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile?
The IUPAC name of 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile (CID 123460708) is 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile.
What is the SMILES notation for 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile?
The canonical SMILES for 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile is CC1CN(c2ncc(Sc3ccc(C#N)cc3)c(OCc3ccccc3)n2)C(C)CN1C.
What is the InChIKey of 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile?
The InChIKey is ORRAKGDDYALOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N5OS/c1-18-16-30(19(2)15-29(18)3)25-27-14-23(32-22-11-9-20(13-26)10-12-22)24(28-25)31-17-21-7-5-4-6-8-21/h4-12,14,18-19H,15-17H2,1-3H3.
What are the key properties of 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile?
4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile has a molecular weight of 445.59 g/mol, XLogP of 4.61, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-phenylmethoxy-2-(2,4,5-trimethylpiperazin-1-yl)pyrimidin-5-yl]sulfanylbenzonitrile is sourced from PubChem (CID 123460708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).