C21H33F2N — CID 123461061
5,5-difluoro-4,7-dimethyl-6-prop-1-enyl-6,7-bis(prop-1-en-2-yl)deca-2,9-dien-4-amine (PubChem CID 123461061) has the molecular formula C21H33F2N and a molecular weight of 337.50 g/mol. Its IUPAC name is 5,5-difluoro-4,7-dimethyl-6-prop-1-enyl-6,7-bis(prop-1-en-2-yl)deca-2,9-dien-4-amine.
| Compound Name | 5,5-difluoro-4,7-dimethyl-6-prop-1-enyl-6,7-bis(prop-1-en-2-yl)deca-2,9-dien-4-amine |
|---|---|
| PubChem CID | 123461061 |
| Molecular Formula | C21H33F2N |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 5,5-difluoro-4,7-dimethyl-6-prop-1-enyl-6,7-bis(prop-1-en-2-yl)deca-2,9-dien-4-amine |
| SMILES | C=CCC(C)(C(=C)C)C(C=CC)(C(=C)C)C(F)(F)C(C)(N)C=CC |
| InChI | InChI=1S/C21H33F2N/c1-10-13-18(8,16(4)5)20(15-12-3,17(6)7)21(22,23)19(9,24)14-11-2/h10-12,14-15H,1,4,6,13,24H2,2-3,5,7-9H3 |
| InChIKey | XHKFTGWPJPGWIN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|