C7H11NO2S — CID 123461234
1-(2,5-dimethyl-1,3-thiazol-4-yl)ethane-1,2-diol (PubChem CID 123461234) has the molecular formula C7H11NO2S and a molecular weight of 173.24 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethane-1,2-diol.
| Compound Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 123461234 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethane-1,2-diol |
| SMILES | Cc1nc(C(O)CO)c(C)s1 |
| InChI | InChI=1S/C7H11NO2S/c1-4-7(6(10)3-9)8-5(2)11-4/h6,9-10H,3H2,1-2H3 |
| InChIKey | CGZYOSZRCPANFK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |