C17H28N4OS — CID 123461242
N-[1-[[1-[3-[dimethyl(oxo)-λ6-sulfanylidene]propyl]piperidin-3-yl]methyl]-4-ethenylpyrazol-5-yl]methanimine (PubChem CID 123461242) has the molecular formula C17H28N4OS and a molecular weight of 336.51 g/mol. Its IUPAC name is N-[1-[[1-[3-[dimethyl(oxo)-λ6-sulfanylidene]propyl]piperidin-3-yl]methyl]-4-ethenylpyrazol-5-yl]methanimine.
| Compound Name | N-[1-[[1-[3-[dimethyl(oxo)-λ6-sulfanylidene]propyl]piperidin-3-yl]methyl]-4-ethenylpyrazol-5-yl]methanimine |
|---|---|
| PubChem CID | 123461242 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.51 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[1-[[1-[3-[dimethyl(oxo)-λ6-sulfanylidene]propyl]piperidin-3-yl]methyl]-4-ethenylpyrazol-5-yl]methanimine |
| SMILES | C=Cc1cnn(CC2CCCN(CCC=S(C)(C)=O)C2)c1N=C |
| InChI | InChI=1S/C17H28N4OS/c1-5-16-12-19-21(17(16)18-2)14-15-8-6-9-20(13-15)10-7-11-23(3,4)22/h5,11-12,15H,1-2,6-10,13-14H2,3-4H3 |
| InChIKey | QIPSFLJISVIFGS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|