C12H22N2O2 — CID 123461465
3-(2,2-dimethylpentyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 123461465) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(2,2-dimethylpentyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(2,2-dimethylpentyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 123461465 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-(2,2-dimethylpentyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCCC(C)(C)CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C12H22N2O2/c1-6-7-11(2,3)8-14-9(15)12(4,5)13-10(14)16/h6-8H2,1-5H3,(H,13,16) |
| InChIKey | ZIPWVCGZUWJURN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|