C21H33F3O6 — CID 123461545
(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2-methylbutanoate (PubChem CID 123461545) has the molecular formula C21H33F3O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2-methylbutanoate.
| Compound Name | (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2-methylbutanoate |
|---|---|
| PubChem CID | 123461545 |
| Molecular Formula | C21H33F3O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate;1,1,1-trifluoropropan-2-yl 2-methylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2CCCC21.CCC(C)C(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C13H20O4.C8H13F3O2/c1-4-13(2,3)12(15)17-10-8-6-5-7-9(8)16-11(10)14;1-4-5(2)7(12)13-6(3)8(9,10)11/h8-10H,4-7H2,1-3H3;5-6H,4H2,1-3H3 |
| InChIKey | YXHZUZOZAJBXKQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|