About tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate
tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate (PubChem CID 123461858) has the molecular formula C11H20N4O3
and a molecular weight of 256.31 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate |
| PubChem CID | 123461858 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC1=NCC(=O)CN1 |
| InChI | InChI=1S/C11H20N4O3/c1-11(2,3)18-10(17)13-5-4-12-9-14-6-8(16)7-15-9/h4-7H2,1-3H3,(H,13,17)(H2,12,14,15) |
| InChIKey | MLYJLGVJNJLTCK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate (CID 123461858) is tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate is CC(C)(C)OC(=O)NCCNC1=NCC(=O)CN1.
What is the InChIKey of tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate?
The InChIKey is MLYJLGVJNJLTCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O3/c1-11(2,3)18-10(17)13-5-4-12-9-14-6-8(16)7-15-9/h4-7H2,1-3H3,(H,13,17)(H2,12,14,15).
What are the key properties of tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate?
tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate has a molecular weight of 256.31 g/mol, XLogP of -0.37, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(5-oxo-4,6-dihydro-1H-pyrimidin-2-yl)amino]ethyl]carbamate is sourced from PubChem (CID 123461858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).