C23H17FN2O2S — CID 123462800
5-[4-[[(1R)-4-(6-fluoro-3-pyridinyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one (PubChem CID 123462800) has the molecular formula C23H17FN2O2S and a molecular weight of 404.47 g/mol. Its IUPAC name is 5-[4-[[(1R)-4-(6-fluoro-3-pyridinyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one.
| Compound Name | 5-[4-[[(1R)-4-(6-fluoro-3-pyridinyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 123462800 |
| Molecular Formula | C23H17FN2O2S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 5-[4-[[(1R)-4-(6-fluoro-3-pyridinyl)-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,2-thiazol-3-one |
| SMILES | O=c1cc(-c2ccc(O[C@@H]3CCc4c(-c5ccc(F)nc5)cccc43)cc2)s[nH]1 |
| InChI | InChI=1S/C23H17FN2O2S/c24-22-11-6-15(13-25-22)17-2-1-3-19-18(17)9-10-20(19)28-16-7-4-14(5-8-16)21-12-23(27)26-29-21/h1-8,11-13,20H,9-10H2,(H,26,27)/t20-/m1/s1 |
| InChIKey | VJRPMDBJYCYUGT-HXUWFJFHSA-N |
| XLogP | 5.37 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|