About 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine
2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine (PubChem CID 123462970) has the molecular formula C19H28FN3
and a molecular weight of 317.45 g/mol. Its IUPAC name is 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine |
| PubChem CID | 123462970 |
| Molecular Formula | C19H28FN3 |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CCC(CC)c1nc(-c2ccc(F)c(C)c2)cn1CCN(C)C |
| InChI | InChI=1S/C19H28FN3/c1-6-15(7-2)19-21-18(13-23(19)11-10-22(4)5)16-8-9-17(20)14(3)12-16/h8-9,12-13,15H,6-7,10-11H2,1-5H3 |
| InChIKey | BZXJBIJOHXROTK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine (CID 123462970) is 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine is CCC(CC)c1nc(-c2ccc(F)c(C)c2)cn1CCN(C)C.
What is the InChIKey of 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine?
The InChIKey is BZXJBIJOHXROTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28FN3/c1-6-15(7-2)19-21-18(13-23(19)11-10-22(4)5)16-8-9-17(20)14(3)12-16/h8-9,12-13,15H,6-7,10-11H2,1-5H3.
What are the key properties of 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine?
2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine has a molecular weight of 317.45 g/mol, XLogP of 4.46, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-fluoro-3-methylphenyl)-2-pentan-3-ylimidazol-1-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 123462970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).