C14H22O — CID 123463134
8-methyl-2,3,4,4a,5a,6,9,10,10a,10b-decahydro-1H-cyclohepta[b][1]benzofuran (PubChem CID 123463134) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 8-methyl-2,3,4,4a,5a,6,9,10,10a,10b-decahydro-1H-cyclohepta[b][1]benzofuran.
| Compound Name | 8-methyl-2,3,4,4a,5a,6,9,10,10a,10b-decahydro-1H-cyclohepta[b][1]benzofuran |
|---|---|
| PubChem CID | 123463134 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 8-methyl-2,3,4,4a,5a,6,9,10,10a,10b-decahydro-1H-cyclohepta[b][1]benzofuran |
| SMILES | CC1=CCC2OC3CCCCC3C2CC1 |
| InChI | InChI=1S/C14H22O/c1-10-6-8-12-11-4-2-3-5-13(11)15-14(12)9-7-10/h7,11-14H,2-6,8-9H2,1H3 |
| InChIKey | ANLSFBXWOQRIMV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|