C21H40O3Si — CID 123463497
(6S,7S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-12-propan-2-yl-1-oxacyclododec-9-en-2-one (PubChem CID 123463497) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (6S,7S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-12-propan-2-yl-1-oxacyclododec-9-en-2-one.
| Compound Name | (6S,7S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-12-propan-2-yl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 123463497 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (6S,7S,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7-methyl-12-propan-2-yl-1-oxacyclododec-9-en-2-one |
| SMILES | CC(C)[C@H]1CC=CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)CCCC(=O)O1 |
| InChI | InChI=1S/C21H40O3Si/c1-16(2)18-13-10-9-12-17(3)19(14-11-15-20(22)23-18)24-25(7,8)21(4,5)6/h9-10,16-19H,11-15H2,1-8H3/t17-,18+,19-/m0/s1 |
| InChIKey | MHCLUZOAWKDPFG-OTWHNJEPSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|