C27H24ClN7O — CID 123463679
(Z)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-isocyano-1-(4-methylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 123463679) has the molecular formula C27H24ClN7O and a molecular weight of 497.99 g/mol. Its IUPAC name is (Z)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-isocyano-1-(4-methylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (Z)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-isocyano-1-(4-methylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123463679 |
| Molecular Formula | C27H24ClN7O |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | (Z)-3-[3-[4-amino-5-(4-chlorophenyl)pyrrolo[2,3-d]pyrimidin-7-yl]phenyl]-2-isocyano-1-(4-methylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | [C-]#[N+]/C(=C\c1cccc(-n2cc(-c3ccc(Cl)cc3)c3c(N)ncnc32)c1)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C27H24ClN7O/c1-30-23(27(36)34-12-10-33(2)11-13-34)15-18-4-3-5-21(14-18)35-16-22(19-6-8-20(28)9-7-19)24-25(29)31-17-32-26(24)35/h3-9,14-17H,10-13H2,2H3,(H2,29,31,32)/b23-15- |
| InChIKey | OOKWMQALYXPOIS-HAHDFKILSA-N |
| XLogP | 4.36 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|