C21H23BBrClN2O2 — CID 123464077
1-[(2-bromo-6-chlorophenyl)methyl]-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 123464077) has the molecular formula C21H23BBrClN2O2 and a molecular weight of 461.60 g/mol. Its IUPAC name is 1-[(2-bromo-6-chlorophenyl)methyl]-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 1-[(2-bromo-6-chlorophenyl)methyl]-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 123464077 |
| Molecular Formula | C21H23BBrClN2O2 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 1-[(2-bromo-6-chlorophenyl)methyl]-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Br)c2cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C21H23BBrClN2O2/c1-13-15-10-9-14(22-27-20(2,3)21(4,5)28-22)11-19(15)26(25-13)12-16-17(23)7-6-8-18(16)24/h6-11H,12H2,1-5H3 |
| InChIKey | VEKXJWUHJPIHAM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|