About [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid
[4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid (PubChem CID 123464389) has the molecular formula C19H25N2O8P
and a molecular weight of 440.39 g/mol. Its IUPAC name is [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid.
Molecular Properties
| Compound Name | [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid |
| PubChem CID | 123464389 |
| Molecular Formula | C19H25N2O8P |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid |
| SMILES | O=C(Cc1ccc(CP(=O)(O)O)cc1)NCCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C19H25N2O8P/c22-16(12-14-5-7-15(8-6-14)13-30(26,27)28)20-11-3-1-2-4-19(25)29-21-17(23)9-10-18(21)24/h5-10,23-24H,1-4,11-13H2,(H,20,22)(H2,26,27,28) |
| InChIKey | ZCRBARUTCWAGGT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 158.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid?
The IUPAC name of [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid (CID 123464389) is [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid.
What is the SMILES notation for [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid?
The canonical SMILES for [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid is O=C(Cc1ccc(CP(=O)(O)O)cc1)NCCCCCC(=O)On1c(O)ccc1O.
What is the InChIKey of [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid?
The InChIKey is ZCRBARUTCWAGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N2O8P/c22-16(12-14-5-7-15(8-6-14)13-30(26,27)28)20-11-3-1-2-4-19(25)29-21-17(23)9-10-18(21)24/h5-10,23-24H,1-4,11-13H2,(H,20,22)(H2,26,27,28).
What are the key properties of [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid?
[4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid has a molecular weight of 440.39 g/mol, XLogP of 1.45, 11 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[[6-(2,5-dihydroxypyrrol-1-yl)oxy-6-oxohexyl]amino]-2-oxoethyl]phenyl]methylphosphonic acid is sourced from PubChem (CID 123464389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).