C13H18N2 — CID 123464597
1-cyclohexa-2,4-dien-1-yl-1-hepta-2,4,6-trien-2-ylhydrazine (PubChem CID 123464597) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-1-hepta-2,4,6-trien-2-ylhydrazine.
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-1-hepta-2,4,6-trien-2-ylhydrazine |
|---|---|
| PubChem CID | 123464597 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-1-hepta-2,4,6-trien-2-ylhydrazine |
| SMILES | C=CC=CC=C(C)N(N)C1C=CC=CC1 |
| InChI | InChI=1S/C13H18N2/c1-3-4-6-9-12(2)15(14)13-10-7-5-8-11-13/h3-10,13H,1,11,14H2,2H3 |
| InChIKey | VLZMTUPUBBHQRY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|