C23H20N4 — CID 123464625
2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]phenyl]acetonitrile (PubChem CID 123464625) has the molecular formula C23H20N4 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]phenyl]acetonitrile.
| Compound Name | 2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 123464625 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[4-[2-(5-amino-8-methylbenzo[f][1,7]naphthyridin-1-yl)ethyl]phenyl]acetonitrile |
| SMILES | Cc1ccc2c(c1)nc(N)c1nccc(CCc3ccc(CC#N)cc3)c12 |
| InChI | InChI=1S/C23H20N4/c1-15-2-9-19-20(14-15)27-23(25)22-21(19)18(11-13-26-22)8-7-16-3-5-17(6-4-16)10-12-24/h2-6,9,11,13-14H,7-8,10H2,1H3,(H2,25,27) |
| InChIKey | HDFAWYBHDLSAFX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|