C24H34F3N — CID 123464797
3-ethylidene-5-methyl-4-prop-1-enyl-N-[4-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butyl]hepta-4,6-dien-2-amine (PubChem CID 123464797) has the molecular formula C24H34F3N and a molecular weight of 393.54 g/mol. Its IUPAC name is 3-ethylidene-5-methyl-4-prop-1-enyl-N-[4-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butyl]hepta-4,6-dien-2-amine.
| Compound Name | 3-ethylidene-5-methyl-4-prop-1-enyl-N-[4-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butyl]hepta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 123464797 |
| Molecular Formula | C24H34F3N |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 3-ethylidene-5-methyl-4-prop-1-enyl-N-[4-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]butyl]hepta-4,6-dien-2-amine |
| SMILES | C=CC(C)=C(C=CC)C(=CC)C(C)NCCCCC1C=CC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C24H34F3N/c1-6-12-23(18(4)7-2)22(8-3)19(5)28-16-10-9-13-20-14-11-15-21(17-20)24(25,26)27/h6-8,11-12,14-15,19-20,28H,2,9-10,13,16-17H2,1,3-5H3 |
| InChIKey | GTZCSSITEOGDQC-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|