C20H24N6O3S — CID 123464932
N-(phenylmethoxymethyl)-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-sulfonamide (PubChem CID 123464932) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-(phenylmethoxymethyl)-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-sulfonamide.
| Compound Name | N-(phenylmethoxymethyl)-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-sulfonamide |
|---|---|
| PubChem CID | 123464932 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-(phenylmethoxymethyl)-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-sulfonamide |
| SMILES | O=S(=O)(NCOCc1ccccc1)N1CCN(c2ncnc3[nH]ccc23)CC12CC2 |
| InChI | InChI=1S/C20H24N6O3S/c27-30(28,24-15-29-12-16-4-2-1-3-5-16)26-11-10-25(13-20(26)7-8-20)19-17-6-9-21-18(17)22-14-23-19/h1-6,9,14,24H,7-8,10-13,15H2,(H,21,22,23) |
| InChIKey | ZSSAVKLVAYIPNY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|