About 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium
2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium (PubChem CID 123465064) has the molecular formula C6H6N3+
and a molecular weight of 120.13 g/mol. Its IUPAC name is 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium.
Molecular Properties
| Compound Name | 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium |
| PubChem CID | 123465064 |
| Molecular Formula | C6H6N3+ |
| Molecular Weight | 120.13 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium |
| SMILES | c1cc[n+]2c(c1)=NCN=2 |
| InChI | InChI=1S/C6H6N3/c1-2-4-9-6(3-1)7-5-8-9/h1-4H,5H2/q+1 |
| InChIKey | QMDGQFPLRMTIEP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 30.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium?
The IUPAC name of 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium (CID 123465064) is 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium.
What is the SMILES notation for 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium?
The canonical SMILES for 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium is c1cc[n+]2c(c1)=NCN=2.
What is the InChIKey of 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium?
The InChIKey is QMDGQFPLRMTIEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N3/c1-2-4-9-6(3-1)7-5-8-9/h1-4H,5H2/q+1.
What are the key properties of 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium?
2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium has a molecular weight of 120.13 g/mol, XLogP of -0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-[1,2,4]triazolo[1,5-a]pyridin-4-ium is sourced from PubChem (CID 123465064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).