C25H27FN2O4 — CID 123465643
[3-[[5-fluoro-3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl]-[3-(methoxymethyl)-1H-indol-2-yl]methanone (PubChem CID 123465643) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is [3-[[5-fluoro-3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl]-[3-(methoxymethyl)-1H-indol-2-yl]methanone.
| Compound Name | [3-[[5-fluoro-3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl]-[3-(methoxymethyl)-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 123465643 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | [3-[[5-fluoro-3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl]-[3-(methoxymethyl)-1H-indol-2-yl]methanone |
| SMILES | COCc1c(C(=O)C2CC(Oc3ncc(F)cc3C3CCOCC3)C2)[nH]c2ccccc12 |
| InChI | InChI=1S/C25H27FN2O4/c1-30-14-21-19-4-2-3-5-22(19)28-23(21)24(29)16-10-18(11-16)32-25-20(12-17(26)13-27-25)15-6-8-31-9-7-15/h2-5,12-13,15-16,18,28H,6-11,14H2,1H3 |
| InChIKey | YCIWLQOAYOJAGG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|