C17H26N2 — CID 123465698
1-(4-propan-2-yl-4a,7,8,8a-tetrahydronaphthalen-2-yl)piperazine (PubChem CID 123465698) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-(4-propan-2-yl-4a,7,8,8a-tetrahydronaphthalen-2-yl)piperazine.
| Compound Name | 1-(4-propan-2-yl-4a,7,8,8a-tetrahydronaphthalen-2-yl)piperazine |
|---|---|
| PubChem CID | 123465698 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-(4-propan-2-yl-4a,7,8,8a-tetrahydronaphthalen-2-yl)piperazine |
| SMILES | CC(C)C1=CC(N2CCNCC2)=CC2CCC=CC12 |
| InChI | InChI=1S/C17H26N2/c1-13(2)17-12-15(19-9-7-18-8-10-19)11-14-5-3-4-6-16(14)17/h4,6,11-14,16,18H,3,5,7-10H2,1-2H3 |
| InChIKey | DRDUSZQZHCYGPK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|