C16H23F7OS — CID 123465752
ethylidene-[(E)-3-ethyl-7,8,8,8-tetrafluoro-2-methyl-6-methylidene-7-(trifluoromethyl)oct-4-en-4-yl]-methyl-oxo-λ6-sulfane (PubChem CID 123465752) has the molecular formula C16H23F7OS and a molecular weight of 396.41 g/mol. Its IUPAC name is ethylidene-[(E)-3-ethyl-7,8,8,8-tetrafluoro-2-methyl-6-methylidene-7-(trifluoromethyl)oct-4-en-4-yl]-methyl-oxo-λ6-sulfane.
| Compound Name | ethylidene-[(E)-3-ethyl-7,8,8,8-tetrafluoro-2-methyl-6-methylidene-7-(trifluoromethyl)oct-4-en-4-yl]-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 123465752 |
| Molecular Formula | C16H23F7OS |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | ethylidene-[(E)-3-ethyl-7,8,8,8-tetrafluoro-2-methyl-6-methylidene-7-(trifluoromethyl)oct-4-en-4-yl]-methyl-oxo-λ6-sulfane |
| SMILES | C=C(/C=C(\C(CC)C(C)C)S(C)(=O)=CC)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H23F7OS/c1-7-12(10(3)4)13(25(6,24)8-2)9-11(5)14(17,15(18,19)20)16(21,22)23/h8-10,12H,5,7H2,1-4,6H3/b13-9+ |
| InChIKey | GCOOSHKNZTYTGL-UKTHLTGXSA-N |
| XLogP | 5.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|