C5H6ClFN2O — CID 123466204
5-(chloromethyl)-3-(1-fluoroethyl)-1,2,4-oxadiazole (PubChem CID 123466204) has the molecular formula C5H6ClFN2O and a molecular weight of 164.57 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(1-fluoroethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(chloromethyl)-3-(1-fluoroethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 123466204 |
| Molecular Formula | C5H6ClFN2O |
| Molecular Weight | 164.57 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 5-(chloromethyl)-3-(1-fluoroethyl)-1,2,4-oxadiazole |
| SMILES | CC(F)c1noc(CCl)n1 |
| InChI | InChI=1S/C5H6ClFN2O/c1-3(7)5-8-4(2-6)10-9-5/h3H,2H2,1H3 |
| InChIKey | ODPLDVYYABNCRC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|