C24H20F6N7O+ — CID 123466422
[3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoylamino]-ethyl-methyl-quinoxalin-2-ylazanium (PubChem CID 123466422) has the molecular formula C24H20F6N7O+ and a molecular weight of 536.46 g/mol. Its IUPAC name is [3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoylamino]-ethyl-methyl-quinoxalin-2-ylazanium.
| Compound Name | [3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoylamino]-ethyl-methyl-quinoxalin-2-ylazanium |
|---|---|
| PubChem CID | 123466422 |
| Molecular Formula | C24H20F6N7O+ |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | [3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoylamino]-ethyl-methyl-quinoxalin-2-ylazanium |
| SMILES | CC[N+](C)(NC(=O)C=Cn1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C24H19F6N7O/c1-3-37(2,20-13-31-18-6-4-5-7-19(18)33-20)35-21(38)8-9-36-14-32-22(34-36)15-10-16(23(25,26)27)12-17(11-15)24(28,29)30/h4-14H,3H2,1-2H3/p+1 |
| InChIKey | KPCWWUGSNVNDGE-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|