C23H43N2+ — CID 123466464
[7-(1-aminoethyl)-2,8,10-trimethyl-5-(3-methylbutyl)undec-10-enylidene]-ethenylideneazanium (PubChem CID 123466464) has the molecular formula C23H43N2+ and a molecular weight of 347.61 g/mol. Its IUPAC name is [7-(1-aminoethyl)-2,8,10-trimethyl-5-(3-methylbutyl)undec-10-enylidene]-ethenylideneazanium.
| Compound Name | [7-(1-aminoethyl)-2,8,10-trimethyl-5-(3-methylbutyl)undec-10-enylidene]-ethenylideneazanium |
|---|---|
| PubChem CID | 123466464 |
| Molecular Formula | C23H43N2+ |
| Molecular Weight | 347.61 g/mol |
| Exact Mass | 347.34 |
| IUPAC Name | [7-(1-aminoethyl)-2,8,10-trimethyl-5-(3-methylbutyl)undec-10-enylidene]-ethenylideneazanium |
| SMILES | C=C=[N+]=CC(C)CCC(CCC(C)C)CC(C(C)N)C(C)CC(=C)C |
| InChI | InChI=1S/C23H43N2/c1-9-25-16-19(6)11-13-22(12-10-17(2)3)15-23(21(8)24)20(7)14-18(4)5/h16-17,19-23H,1,4,10-15,24H2,2-3,5-8H3/q+1 |
| InChIKey | SGXQWZBQCRHJJI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|