C24H26FNO2 — CID 123466842
4-(3-fluorophenyl)-2-(oxolan-3-yloxy)-3-pent-1-ynyl-5,6,7,8-tetrahydroquinoline (PubChem CID 123466842) has the molecular formula C24H26FNO2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-2-(oxolan-3-yloxy)-3-pent-1-ynyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 4-(3-fluorophenyl)-2-(oxolan-3-yloxy)-3-pent-1-ynyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 123466842 |
| Molecular Formula | C24H26FNO2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-(3-fluorophenyl)-2-(oxolan-3-yloxy)-3-pent-1-ynyl-5,6,7,8-tetrahydroquinoline |
| SMILES | CCCC#Cc1c(OC2CCOC2)nc2c(c1-c1cccc(F)c1)CCCC2 |
| InChI | InChI=1S/C24H26FNO2/c1-2-3-4-11-21-23(17-8-7-9-18(25)15-17)20-10-5-6-12-22(20)26-24(21)28-19-13-14-27-16-19/h7-9,15,19H,2-3,5-6,10,12-14,16H2,1H3 |
| InChIKey | IVZOEVYMLPJZFM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|