About octyl N-ethylidenecarbamate
octyl N-ethylidenecarbamate (PubChem CID 123466877) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is octyl N-ethylidenecarbamate.
Molecular Properties
| Compound Name | octyl N-ethylidenecarbamate |
| PubChem CID | 123466877 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | octyl N-ethylidenecarbamate |
| SMILES | CC=NC(=O)OCCCCCCCC |
| InChI | InChI=1S/C11H21NO2/c1-3-5-6-7-8-9-10-14-11(13)12-4-2/h4H,3,5-10H2,1-2H3 |
| InChIKey | QCIZKCWJFZSVRO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze octyl N-ethylidenecarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl N-ethylidenecarbamate?
The IUPAC name of octyl N-ethylidenecarbamate (CID 123466877) is octyl N-ethylidenecarbamate.
What is the SMILES notation for octyl N-ethylidenecarbamate?
The canonical SMILES for octyl N-ethylidenecarbamate is CC=NC(=O)OCCCCCCCC.
What is the InChIKey of octyl N-ethylidenecarbamate?
The InChIKey is QCIZKCWJFZSVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-3-5-6-7-8-9-10-14-11(13)12-4-2/h4H,3,5-10H2,1-2H3.
What are the key properties of octyl N-ethylidenecarbamate?
octyl N-ethylidenecarbamate has a molecular weight of 199.29 g/mol, XLogP of 3.57, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octyl N-ethylidenecarbamate is sourced from PubChem (CID 123466877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).