About 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole
5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole (PubChem CID 123467053) has the molecular formula C16H10Cl2F3NO
and a molecular weight of 360.16 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole |
| PubChem CID | 123467053 |
| Molecular Formula | C16H10Cl2F3NO |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole |
| SMILES | FC(F)(F)C1(c2cc(Cl)cc(Cl)c2)C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C16H10Cl2F3NO/c17-12-6-11(7-13(18)8-12)15(16(19,20)21)9-14(22-23-15)10-4-2-1-3-5-10/h1-9,22H |
| InChIKey | FKNYIRIVQYRMBY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole?
The IUPAC name of 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole (CID 123467053) is 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole?
The canonical SMILES for 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole is FC(F)(F)C1(c2cc(Cl)cc(Cl)c2)C=C(c2ccccc2)NO1.
What is the InChIKey of 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole?
The InChIKey is FKNYIRIVQYRMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2F3NO/c17-12-6-11(7-13(18)8-12)15(16(19,20)21)9-14(22-23-15)10-4-2-1-3-5-10/h1-9,22H.
What are the key properties of 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole?
5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole has a molecular weight of 360.16 g/mol, XLogP of 5.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-3-phenyl-5-(trifluoromethyl)-2H-1,2-oxazole is sourced from PubChem (CID 123467053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).