C14H22N2 — CID 123467800
(Z,2E)-N-[(Z)-[(Z)-hex-4-en-3-ylidene]amino]-2,5-dimethylhexa-2,4-dien-1-imine (PubChem CID 123467800) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (Z,2E)-N-[(Z)-[(Z)-hex-4-en-3-ylidene]amino]-2,5-dimethylhexa-2,4-dien-1-imine.
| Compound Name | (Z,2E)-N-[(Z)-[(Z)-hex-4-en-3-ylidene]amino]-2,5-dimethylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123467800 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (Z,2E)-N-[(Z)-[(Z)-hex-4-en-3-ylidene]amino]-2,5-dimethylhexa-2,4-dien-1-imine |
| SMILES | C/C=C\C(CC)=N/N=C\C(C)=C\C=C(C)C |
| InChI | InChI=1S/C14H22N2/c1-6-8-14(7-2)16-15-11-13(5)10-9-12(3)4/h6,8-11H,7H2,1-5H3/b8-6-,13-10+,15-11-,16-14- |
| InChIKey | DAJDBPAGNUJTTF-UQSXUTTASA-N |
| XLogP | 4.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|