About 3-ethyl-N,4-dimethylhept-5-en-2-amine
3-ethyl-N,4-dimethylhept-5-en-2-amine (PubChem CID 123467838) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is 3-ethyl-N,4-dimethylhept-5-en-2-amine.
Molecular Properties
| Compound Name | 3-ethyl-N,4-dimethylhept-5-en-2-amine |
| PubChem CID | 123467838 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 3-ethyl-N,4-dimethylhept-5-en-2-amine |
| SMILES | CC=CC(C)C(CC)C(C)NC |
| InChI | InChI=1S/C11H23N/c1-6-8-9(3)11(7-2)10(4)12-5/h6,8-12H,7H2,1-5H3 |
| InChIKey | DPAYSULXEPIQFP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N,4-dimethylhept-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,4-dimethylhept-5-en-2-amine?
The IUPAC name of 3-ethyl-N,4-dimethylhept-5-en-2-amine (CID 123467838) is 3-ethyl-N,4-dimethylhept-5-en-2-amine.
What is the SMILES notation for 3-ethyl-N,4-dimethylhept-5-en-2-amine?
The canonical SMILES for 3-ethyl-N,4-dimethylhept-5-en-2-amine is CC=CC(C)C(CC)C(C)NC.
What is the InChIKey of 3-ethyl-N,4-dimethylhept-5-en-2-amine?
The InChIKey is DPAYSULXEPIQFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-6-8-9(3)11(7-2)10(4)12-5/h6,8-12H,7H2,1-5H3.
What are the key properties of 3-ethyl-N,4-dimethylhept-5-en-2-amine?
3-ethyl-N,4-dimethylhept-5-en-2-amine has a molecular weight of 169.31 g/mol, XLogP of 2.83, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,4-dimethylhept-5-en-2-amine is sourced from PubChem (CID 123467838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).