About ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate
ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate (PubChem CID 123468241) has the molecular formula C7H10N2O4S2
and a molecular weight of 250.30 g/mol. Its IUPAC name is ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate.
Molecular Properties
| Compound Name | ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate |
| PubChem CID | 123468241 |
| Molecular Formula | C7H10N2O4S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate |
| SMILES | CCOC(=O)N(C)S(=O)(=O)c1cncs1 |
| InChI | InChI=1S/C7H10N2O4S2/c1-3-13-7(10)9(2)15(11,12)6-4-8-5-14-6/h4-5H,3H2,1-2H3 |
| InChIKey | ULGBFEFGDIZLCD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate?
The IUPAC name of ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate (CID 123468241) is ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate.
What is the SMILES notation for ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate?
The canonical SMILES for ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate is CCOC(=O)N(C)S(=O)(=O)c1cncs1.
What is the InChIKey of ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate?
The InChIKey is ULGBFEFGDIZLCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4S2/c1-3-13-7(10)9(2)15(11,12)6-4-8-5-14-6/h4-5H,3H2,1-2H3.
What are the key properties of ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate?
ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate has a molecular weight of 250.30 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-methyl-N-(1,3-thiazol-5-ylsulfonyl)carbamate is sourced from PubChem (CID 123468241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).