C14H29N3 — CID 123468582
3,13-dimethyl-1,4,7-triazabicyclo[8.5.0]pentadecane (PubChem CID 123468582) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is 3,13-dimethyl-1,4,7-triazabicyclo[8.5.0]pentadecane.
| Compound Name | 3,13-dimethyl-1,4,7-triazabicyclo[8.5.0]pentadecane |
|---|---|
| PubChem CID | 123468582 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 3,13-dimethyl-1,4,7-triazabicyclo[8.5.0]pentadecane |
| SMILES | CC1CCC2CCNCCNC(C)CN2CC1 |
| InChI | InChI=1S/C14H29N3/c1-12-3-4-14-5-7-15-8-9-16-13(2)11-17(14)10-6-12/h12-16H,3-11H2,1-2H3 |
| InChIKey | QSWZTNJROGQSLV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |